C20H24O4 — CID 27235123
2-[(2E)-2-[(2S)-7-methoxy-2-methyl-2,3-dihydrochromen-4-ylidene]ethyl]-2-methylcyclohexane-1,3-dione (PubChem CID 27235123) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is 2-[(2E)-2-[(2S)-7-methoxy-2-methyl-2,3-dihydrochromen-4-ylidene]ethyl]-2-methylcyclohexane-1,3-dione.
| Compound Name | 2-[(2E)-2-[(2S)-7-methoxy-2-methyl-2,3-dihydrochromen-4-ylidene]ethyl]-2-methylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 27235123 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 2-[(2E)-2-[(2S)-7-methoxy-2-methyl-2,3-dihydrochromen-4-ylidene]ethyl]-2-methylcyclohexane-1,3-dione |
| SMILES | COc1ccc2c(c1)O[C@@H](C)C/C2=C\CC1(C)C(=O)CCCC1=O |
| InChI | InChI=1S/C20H24O4/c1-13-11-14(16-8-7-15(23-3)12-17(16)24-13)9-10-20(2)18(21)5-4-6-19(20)22/h7-9,12-13H,4-6,10-11H2,1-3H3/b14-9+/t13-/m0/s1 |
| InChIKey | AEKXCPNTFXBUMM-FYQHACEVSA-N |
| XLogP | 3.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|