C13H15NO4 — CID 6160056
[(Z)-(7-methoxy-2-methyl-2,3-dihydrochromen-4-ylidene)amino] acetate (PubChem CID 6160056) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is [(Z)-(7-methoxy-2-methyl-2,3-dihydrochromen-4-ylidene)amino] acetate.
| Compound Name | [(Z)-(7-methoxy-2-methyl-2,3-dihydrochromen-4-ylidene)amino] acetate |
|---|---|
| PubChem CID | 6160056 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | [(Z)-(7-methoxy-2-methyl-2,3-dihydrochromen-4-ylidene)amino] acetate |
| SMILES | COc1ccc2c(c1)OC(C)C/C2=N/OC(C)=O |
| InChI | InChI=1S/C13H15NO4/c1-8-6-12(14-18-9(2)15)11-5-4-10(16-3)7-13(11)17-8/h4-5,7-8H,6H2,1-3H3/b14-12- |
| InChIKey | GXEXGWJEHNFOMV-OWBHPGMISA-N |
| XLogP | 2.13 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|