C18H17NO5 — CID 754830
[(7-methoxy-2,3-dihydrochromen-4-ylidene)amino] 4-methoxybenzoate (PubChem CID 754830) has the molecular formula C18H17NO5 and a molecular weight of 327.34 g/mol. Its IUPAC name is [(7-methoxy-2,3-dihydrochromen-4-ylidene)amino] 4-methoxybenzoate.
| Compound Name | [(7-methoxy-2,3-dihydrochromen-4-ylidene)amino] 4-methoxybenzoate |
|---|---|
| PubChem CID | 754830 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | [(7-methoxy-2,3-dihydrochromen-4-ylidene)amino] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)ON=C2CCOc3cc(OC)ccc32)cc1 |
| InChI | InChI=1S/C18H17NO5/c1-21-13-5-3-12(4-6-13)18(20)24-19-16-9-10-23-17-11-14(22-2)7-8-15(16)17/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | AKHVJPSQMTWEQK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|