C18H16ClNO5 — CID 1106058
[(7-methoxy-2,3-dihydrochromen-4-ylidene)amino] 5-chloro-2-methoxybenzoate (PubChem CID 1106058) has the molecular formula C18H16ClNO5 and a molecular weight of 361.78 g/mol. Its IUPAC name is [(7-methoxy-2,3-dihydrochromen-4-ylidene)amino] 5-chloro-2-methoxybenzoate.
| Compound Name | [(7-methoxy-2,3-dihydrochromen-4-ylidene)amino] 5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 1106058 |
| Molecular Formula | C18H16ClNO5 |
| Molecular Weight | 361.78 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | [(7-methoxy-2,3-dihydrochromen-4-ylidene)amino] 5-chloro-2-methoxybenzoate |
| SMILES | COc1ccc2c(c1)OCCC2=NOC(=O)c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C18H16ClNO5/c1-22-12-4-5-13-15(7-8-24-17(13)10-12)20-25-18(21)14-9-11(19)3-6-16(14)23-2/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | DUOIRQCWDKWOGA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.78 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|