C18H17ClN2O4 — CID 154861455
2-chloro-4-[(2Z)-2-(8-methoxy-3,4-dihydro-2H-1-benzoxepin-5-ylidene)hydrazinyl]benzoic acid (PubChem CID 154861455) has the molecular formula C18H17ClN2O4 and a molecular weight of 360.80 g/mol. Its IUPAC name is 2-chloro-4-[(2Z)-2-(8-methoxy-3,4-dihydro-2H-1-benzoxepin-5-ylidene)hydrazinyl]benzoic acid.
| Compound Name | 2-chloro-4-[(2Z)-2-(8-methoxy-3,4-dihydro-2H-1-benzoxepin-5-ylidene)hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 154861455 |
| Molecular Formula | C18H17ClN2O4 |
| Molecular Weight | 360.80 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 2-chloro-4-[(2Z)-2-(8-methoxy-3,4-dihydro-2H-1-benzoxepin-5-ylidene)hydrazinyl]benzoic acid |
| SMILES | COc1ccc2c(c1)OCCC/C2=N/Nc1ccc(C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C18H17ClN2O4/c1-24-12-5-7-14-16(3-2-8-25-17(14)10-12)21-20-11-4-6-13(18(22)23)15(19)9-11/h4-7,9-10,20H,2-3,8H2,1H3,(H,22,23)/b21-16- |
| InChIKey | QMYKPTQLIBYIHR-PGMHBOJBSA-N |
| XLogP | 4.04 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.80 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|