C16H15NO4S — CID 3855654
[(7-methoxy-2-methyl-2,3-dihydrochromen-4-ylidene)amino] thiophene-2-carboxylate (PubChem CID 3855654) has the molecular formula C16H15NO4S and a molecular weight of 317.37 g/mol. Its IUPAC name is [(7-methoxy-2-methyl-2,3-dihydrochromen-4-ylidene)amino] thiophene-2-carboxylate.
| Compound Name | [(7-methoxy-2-methyl-2,3-dihydrochromen-4-ylidene)amino] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 3855654 |
| Molecular Formula | C16H15NO4S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | [(7-methoxy-2-methyl-2,3-dihydrochromen-4-ylidene)amino] thiophene-2-carboxylate |
| SMILES | COc1ccc2c(c1)OC(C)CC2=NOC(=O)c1cccs1 |
| InChI | InChI=1S/C16H15NO4S/c1-10-8-13(17-21-16(18)15-4-3-7-22-15)12-6-5-11(19-2)9-14(12)20-10/h3-7,9-10H,8H2,1-2H3 |
| InChIKey | QNGHNEFHBIWTEJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|