C18H16BrNO4 — CID 3930546
[(7-methoxy-2-methyl-2,3-dihydrochromen-4-ylidene)amino] 2-bromobenzoate (PubChem CID 3930546) has the molecular formula C18H16BrNO4 and a molecular weight of 390.23 g/mol. Its IUPAC name is [(7-methoxy-2-methyl-2,3-dihydrochromen-4-ylidene)amino] 2-bromobenzoate.
| Compound Name | [(7-methoxy-2-methyl-2,3-dihydrochromen-4-ylidene)amino] 2-bromobenzoate |
|---|---|
| PubChem CID | 3930546 |
| Molecular Formula | C18H16BrNO4 |
| Molecular Weight | 390.23 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | [(7-methoxy-2-methyl-2,3-dihydrochromen-4-ylidene)amino] 2-bromobenzoate |
| SMILES | COc1ccc2c(c1)OC(C)CC2=NOC(=O)c1ccccc1Br |
| InChI | InChI=1S/C18H16BrNO4/c1-11-9-16(14-8-7-12(22-2)10-17(14)23-11)20-24-18(21)13-5-3-4-6-15(13)19/h3-8,10-11H,9H2,1-2H3 |
| InChIKey | SEBBREWUHGJQQS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.23 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|