C25H23NO5 — CID 121301448
methyl 4-[(2R)-7-methoxy-4-phenylmethoxyimino-2,3-dihydrochromen-2-yl]benzoate (PubChem CID 121301448) has the molecular formula C25H23NO5 and a molecular weight of 417.46 g/mol. Its IUPAC name is methyl 4-[(2R)-7-methoxy-4-phenylmethoxyimino-2,3-dihydrochromen-2-yl]benzoate.
| Compound Name | methyl 4-[(2R)-7-methoxy-4-phenylmethoxyimino-2,3-dihydrochromen-2-yl]benzoate |
|---|---|
| PubChem CID | 121301448 |
| Molecular Formula | C25H23NO5 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | methyl 4-[(2R)-7-methoxy-4-phenylmethoxyimino-2,3-dihydrochromen-2-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@H]2CC(=NOCc3ccccc3)c3ccc(OC)cc3O2)cc1 |
| InChI | InChI=1S/C25H23NO5/c1-28-20-12-13-21-22(26-30-16-17-6-4-3-5-7-17)15-23(31-24(21)14-20)18-8-10-19(11-9-18)25(27)29-2/h3-14,23H,15-16H2,1-2H3/t23-/m1/s1 |
| InChIKey | RKXSSOUXIFBKCI-HSZRJFAPSA-N |
| XLogP | 4.93 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|