C17H15NO4 — CID 154406737
4-(4-methoxyimino-2,3-dihydrochromen-2-yl)benzoic acid (PubChem CID 154406737) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is 4-(4-methoxyimino-2,3-dihydrochromen-2-yl)benzoic acid.
| Compound Name | 4-(4-methoxyimino-2,3-dihydrochromen-2-yl)benzoic acid |
|---|---|
| PubChem CID | 154406737 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 4-(4-methoxyimino-2,3-dihydrochromen-2-yl)benzoic acid |
| SMILES | CON=C1CC(c2ccc(C(=O)O)cc2)Oc2ccccc21 |
| InChI | InChI=1S/C17H15NO4/c1-21-18-14-10-16(22-15-5-3-2-4-13(14)15)11-6-8-12(9-7-11)17(19)20/h2-9,16H,10H2,1H3,(H,19,20) |
| InChIKey | LRWXBSVRCFMWSR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|