C22H16ClNO3 — CID 51066863
[(E)-(2-phenyl-2,3-dihydrochromen-4-ylidene)amino] 2-chlorobenzoate (PubChem CID 51066863) has the molecular formula C22H16ClNO3 and a molecular weight of 377.83 g/mol. Its IUPAC name is [(E)-(2-phenyl-2,3-dihydrochromen-4-ylidene)amino] 2-chlorobenzoate.
| Compound Name | [(E)-(2-phenyl-2,3-dihydrochromen-4-ylidene)amino] 2-chlorobenzoate |
|---|---|
| PubChem CID | 51066863 |
| Molecular Formula | C22H16ClNO3 |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | [(E)-(2-phenyl-2,3-dihydrochromen-4-ylidene)amino] 2-chlorobenzoate |
| SMILES | O=C(O/N=C1\CC(c2ccccc2)Oc2ccccc21)c1ccccc1Cl |
| InChI | InChI=1S/C22H16ClNO3/c23-18-12-6-4-10-16(18)22(25)27-24-19-14-21(15-8-2-1-3-9-15)26-20-13-7-5-11-17(19)20/h1-13,21H,14H2/b24-19+ |
| InChIKey | SVNKFZPPSUGFRH-LYBHJNIJSA-N |
| XLogP | 5.42 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|