C21H15Cl3N2O — CID 3586864
2,4,6-trichloro-N-[(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]aniline (PubChem CID 3586864) has the molecular formula C21H15Cl3N2O and a molecular weight of 417.72 g/mol. Its IUPAC name is 2,4,6-trichloro-N-[(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]aniline.
| Compound Name | 2,4,6-trichloro-N-[(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]aniline |
|---|---|
| PubChem CID | 3586864 |
| Molecular Formula | C21H15Cl3N2O |
| Molecular Weight | 417.72 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | 2,4,6-trichloro-N-[(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]aniline |
| SMILES | Clc1cc(Cl)c(NN=C2CC(c3ccccc3)Oc3ccccc32)c(Cl)c1 |
| InChI | InChI=1S/C21H15Cl3N2O/c22-14-10-16(23)21(17(24)11-14)26-25-18-12-20(13-6-2-1-3-7-13)27-19-9-5-4-8-15(18)19/h1-11,20,26H,12H2 |
| InChIKey | UCYUJCFUCBCESH-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.72 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|