C25H24N4O5S — CID 3965718
2-nitro-N-[(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]-4-pyrrolidin-1-ylsulfonylaniline (PubChem CID 3965718) has the molecular formula C25H24N4O5S and a molecular weight of 492.56 g/mol. Its IUPAC name is 2-nitro-N-[(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]-4-pyrrolidin-1-ylsulfonylaniline.
| Compound Name | 2-nitro-N-[(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]-4-pyrrolidin-1-ylsulfonylaniline |
|---|---|
| PubChem CID | 3965718 |
| Molecular Formula | C25H24N4O5S |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 2-nitro-N-[(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]-4-pyrrolidin-1-ylsulfonylaniline |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CCCC2)ccc1NN=C1CC(c2ccccc2)Oc2ccccc21 |
| InChI | InChI=1S/C25H24N4O5S/c30-29(31)23-16-19(35(32,33)28-14-6-7-15-28)12-13-21(23)26-27-22-17-25(18-8-2-1-3-9-18)34-24-11-5-4-10-20(22)24/h1-5,8-13,16,25-26H,6-7,14-15,17H2 |
| InChIKey | JYECQKABJIXPEK-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|