C21H25N3O4S — CID 41024306
N-[(S)-cyclopropyl(phenyl)methyl]-2-nitro-4-piperidin-1-ylsulfonylaniline (PubChem CID 41024306) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is N-[(S)-cyclopropyl(phenyl)methyl]-2-nitro-4-piperidin-1-ylsulfonylaniline.
| Compound Name | N-[(S)-cyclopropyl(phenyl)methyl]-2-nitro-4-piperidin-1-ylsulfonylaniline |
|---|---|
| PubChem CID | 41024306 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | N-[(S)-cyclopropyl(phenyl)methyl]-2-nitro-4-piperidin-1-ylsulfonylaniline |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CCCCC2)ccc1N[C@H](c1ccccc1)C1CC1 |
| InChI | InChI=1S/C21H25N3O4S/c25-24(26)20-15-18(29(27,28)23-13-5-2-6-14-23)11-12-19(20)22-21(17-9-10-17)16-7-3-1-4-8-16/h1,3-4,7-8,11-12,15,17,21-22H,2,5-6,9-10,13-14H2/t21-/m1/s1 |
| InChIKey | XFKQDKPWGDVWIR-OAQYLSRUSA-N |
| XLogP | 4.33 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|