C22H19N3O5S — CID 42912401
4-methyl-3-nitro-N-[(E)-(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]benzenesulfonamide (PubChem CID 42912401) has the molecular formula C22H19N3O5S and a molecular weight of 437.48 g/mol. Its IUPAC name is 4-methyl-3-nitro-N-[(E)-(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]benzenesulfonamide.
| Compound Name | 4-methyl-3-nitro-N-[(E)-(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 42912401 |
| Molecular Formula | C22H19N3O5S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 4-methyl-3-nitro-N-[(E)-(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C2\CC(c3ccccc3)Oc3ccccc32)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H19N3O5S/c1-15-11-12-17(13-20(15)25(26)27)31(28,29)24-23-19-14-22(16-7-3-2-4-8-16)30-21-10-6-5-9-18(19)21/h2-13,22,24H,14H2,1H3/b23-19+ |
| InChIKey | CCISTABPXVHTBI-FCDQGJHFSA-N |
| XLogP | 4.11 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|