C17H17BrN4O4S — CID 5033961
N-[(2-bromophenyl)methylideneamino]-2-nitro-4-pyrrolidin-1-ylsulfonylaniline (PubChem CID 5033961) has the molecular formula C17H17BrN4O4S and a molecular weight of 453.32 g/mol. Its IUPAC name is N-[(2-bromophenyl)methylideneamino]-2-nitro-4-pyrrolidin-1-ylsulfonylaniline.
| Compound Name | N-[(2-bromophenyl)methylideneamino]-2-nitro-4-pyrrolidin-1-ylsulfonylaniline |
|---|---|
| PubChem CID | 5033961 |
| Molecular Formula | C17H17BrN4O4S |
| Molecular Weight | 453.32 g/mol |
| Exact Mass | 452.02 |
| IUPAC Name | N-[(2-bromophenyl)methylideneamino]-2-nitro-4-pyrrolidin-1-ylsulfonylaniline |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CCCC2)ccc1NN=Cc1ccccc1Br |
| InChI | InChI=1S/C17H17BrN4O4S/c18-15-6-2-1-5-13(15)12-19-20-16-8-7-14(11-17(16)22(23)24)27(25,26)21-9-3-4-10-21/h1-2,5-8,11-12,20H,3-4,9-10H2 |
| InChIKey | MEHNKDWPMDNBEK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|