C22H22N4O5S — CID 6137952
N-[(Z)-(2-methoxynaphthalen-1-yl)methylideneamino]-2-nitro-4-pyrrolidin-1-ylsulfonylaniline (PubChem CID 6137952) has the molecular formula C22H22N4O5S and a molecular weight of 454.51 g/mol. Its IUPAC name is N-[(Z)-(2-methoxynaphthalen-1-yl)methylideneamino]-2-nitro-4-pyrrolidin-1-ylsulfonylaniline.
| Compound Name | N-[(Z)-(2-methoxynaphthalen-1-yl)methylideneamino]-2-nitro-4-pyrrolidin-1-ylsulfonylaniline |
|---|---|
| PubChem CID | 6137952 |
| Molecular Formula | C22H22N4O5S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | N-[(Z)-(2-methoxynaphthalen-1-yl)methylideneamino]-2-nitro-4-pyrrolidin-1-ylsulfonylaniline |
| SMILES | COc1ccc2ccccc2c1/C=N\Nc1ccc(S(=O)(=O)N2CCCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H22N4O5S/c1-31-22-11-8-16-6-2-3-7-18(16)19(22)15-23-24-20-10-9-17(14-21(20)26(27)28)32(29,30)25-12-4-5-13-25/h2-3,6-11,14-15,24H,4-5,12-13H2,1H3/b23-15- |
| InChIKey | QWGTXYASDTXUET-HAHDFKILSA-N |
| XLogP | 3.99 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|