C21H17ClN2O — CID 7415283
4-chloro-N-[[(2R)-2-phenyl-2,3-dihydrochromen-4-ylidene]amino]aniline (PubChem CID 7415283) has the molecular formula C21H17ClN2O and a molecular weight of 348.83 g/mol. Its IUPAC name is 4-chloro-N-[[(2R)-2-phenyl-2,3-dihydrochromen-4-ylidene]amino]aniline.
| Compound Name | 4-chloro-N-[[(2R)-2-phenyl-2,3-dihydrochromen-4-ylidene]amino]aniline |
|---|---|
| PubChem CID | 7415283 |
| Molecular Formula | C21H17ClN2O |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 4-chloro-N-[[(2R)-2-phenyl-2,3-dihydrochromen-4-ylidene]amino]aniline |
| SMILES | Clc1ccc(NN=C2C[C@H](c3ccccc3)Oc3ccccc32)cc1 |
| InChI | InChI=1S/C21H17ClN2O/c22-16-10-12-17(13-11-16)23-24-19-14-21(15-6-2-1-3-7-15)25-20-9-5-4-8-18(19)20/h1-13,21,23H,14H2/t21-/m1/s1 |
| InChIKey | FOEOMWIGRVVTFZ-OAQYLSRUSA-N |
| XLogP | 5.68 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|