C22H23NO3 — CID 134107224
[(E)-(2-phenyl-2,3-dihydrochromen-4-ylidene)amino] cyclohexanecarboxylate (PubChem CID 134107224) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is [(E)-(2-phenyl-2,3-dihydrochromen-4-ylidene)amino] cyclohexanecarboxylate.
| Compound Name | [(E)-(2-phenyl-2,3-dihydrochromen-4-ylidene)amino] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 134107224 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | [(E)-(2-phenyl-2,3-dihydrochromen-4-ylidene)amino] cyclohexanecarboxylate |
| SMILES | O=C(O/N=C1\CC(c2ccccc2)Oc2ccccc21)C1CCCCC1 |
| InChI | InChI=1S/C22H23NO3/c24-22(17-11-5-2-6-12-17)26-23-19-15-21(16-9-3-1-4-10-16)25-20-14-8-7-13-18(19)20/h1,3-4,7-10,13-14,17,21H,2,5-6,11-12,15H2/b23-19+ |
| InChIKey | OKBJUZSFNPMELW-FCDQGJHFSA-N |
| XLogP | 5.04 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|