C21H17N3O2 — CID 4969186
N-[(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]pyridine-3-carboxamide (PubChem CID 4969186) has the molecular formula C21H17N3O2 and a molecular weight of 343.39 g/mol. Its IUPAC name is N-[(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]pyridine-3-carboxamide.
| Compound Name | N-[(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 4969186 |
| Molecular Formula | C21H17N3O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | N-[(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]pyridine-3-carboxamide |
| SMILES | O=C(NN=C1CC(c2ccccc2)Oc2ccccc21)c1cccnc1 |
| InChI | InChI=1S/C21H17N3O2/c25-21(16-9-6-12-22-14-16)24-23-18-13-20(15-7-2-1-3-8-15)26-19-11-5-4-10-17(18)19/h1-12,14,20H,13H2,(H,24,25) |
| InChIKey | QBHBTIYFDZZHPR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|