C16H16N4O — CID 12764873
N'-(3-phenyl-3,4-dihydro-2H-pyrrol-5-yl)pyridine-3-carbohydrazide (PubChem CID 12764873) has the molecular formula C16H16N4O and a molecular weight of 280.33 g/mol. Its IUPAC name is N'-(3-phenyl-3,4-dihydro-2H-pyrrol-5-yl)pyridine-3-carbohydrazide.
| Compound Name | N'-(3-phenyl-3,4-dihydro-2H-pyrrol-5-yl)pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 12764873 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | N'-(3-phenyl-3,4-dihydro-2H-pyrrol-5-yl)pyridine-3-carbohydrazide |
| SMILES | O=C(NNC1=NCC(c2ccccc2)C1)c1cccnc1 |
| InChI | InChI=1S/C16H16N4O/c21-16(13-7-4-8-17-10-13)20-19-15-9-14(11-18-15)12-5-2-1-3-6-12/h1-8,10,14H,9,11H2,(H,18,19)(H,20,21) |
| InChIKey | APLXLHFRWIMRSZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|