C22H20N2O4 — CID 171358364
(2S,4E)-2-(4-hydroxyphenyl)-7-methoxy-4-(phenylhydrazinylidene)-2,3-dihydrochromen-5-ol (PubChem CID 171358364) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is (2S,4E)-2-(4-hydroxyphenyl)-7-methoxy-4-(phenylhydrazinylidene)-2,3-dihydrochromen-5-ol.
| Compound Name | (2S,4E)-2-(4-hydroxyphenyl)-7-methoxy-4-(phenylhydrazinylidene)-2,3-dihydrochromen-5-ol |
|---|---|
| PubChem CID | 171358364 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | (2S,4E)-2-(4-hydroxyphenyl)-7-methoxy-4-(phenylhydrazinylidene)-2,3-dihydrochromen-5-ol |
| SMILES | COc1cc(O)c2c(c1)O[C@H](c1ccc(O)cc1)C/C2=N\Nc1ccccc1 |
| InChI | InChI=1S/C22H20N2O4/c1-27-17-11-19(26)22-18(24-23-15-5-3-2-4-6-15)13-20(28-21(22)12-17)14-7-9-16(25)10-8-14/h2-12,20,23,25-26H,13H2,1H3/b24-18+/t20-/m0/s1 |
| InChIKey | HMLIIMCFTGWXMF-AYBPGSHHSA-N |
| XLogP | 4.45 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|