C15H13NO5 — CID 177439381
(2S,4E)-4-hydroxyimino-2-(4-hydroxyphenyl)-2,3-dihydrochromene-5,7-diol (PubChem CID 177439381) has the molecular formula C15H13NO5 and a molecular weight of 287.27 g/mol. Its IUPAC name is (2S,4E)-4-hydroxyimino-2-(4-hydroxyphenyl)-2,3-dihydrochromene-5,7-diol.
| Compound Name | (2S,4E)-4-hydroxyimino-2-(4-hydroxyphenyl)-2,3-dihydrochromene-5,7-diol |
|---|---|
| PubChem CID | 177439381 |
| Molecular Formula | C15H13NO5 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | (2S,4E)-4-hydroxyimino-2-(4-hydroxyphenyl)-2,3-dihydrochromene-5,7-diol |
| SMILES | O/N=C1\C[C@@H](c2ccc(O)cc2)Oc2cc(O)cc(O)c21 |
| InChI | InChI=1S/C15H13NO5/c17-9-3-1-8(2-4-9)13-7-11(16-20)15-12(19)5-10(18)6-14(15)21-13/h1-6,13,17-20H,7H2/b16-11+/t13-/m0/s1 |
| InChIKey | UTHNTUVUMCHRAT-XDUBLRSXSA-N |
| XLogP | 2.51 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|