C15H12O6 — CID 132527547
(2R)-2-(4-hydroxyphenyl)-2H-chromene-3,4,5,7-tetrol (PubChem CID 132527547) has the molecular formula C15H12O6 and a molecular weight of 288.25 g/mol. Its IUPAC name is (2R)-2-(4-hydroxyphenyl)-2H-chromene-3,4,5,7-tetrol.
| Compound Name | (2R)-2-(4-hydroxyphenyl)-2H-chromene-3,4,5,7-tetrol |
|---|---|
| PubChem CID | 132527547 |
| Molecular Formula | C15H12O6 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | (2R)-2-(4-hydroxyphenyl)-2H-chromene-3,4,5,7-tetrol |
| SMILES | OC1=C(O)[C@@H](c2ccc(O)cc2)Oc2cc(O)cc(O)c21 |
| InChI | InChI=1S/C15H12O6/c16-8-3-1-7(2-4-8)15-14(20)13(19)12-10(18)5-9(17)6-11(12)21-15/h1-6,15-20H/t15-/m1/s1 |
| InChIKey | FUCPYEYEEQHBFJ-OAHLLOKOSA-N |
| XLogP | 2.72 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |