C17H18O4 — CID 143810700
(2R)-5,7-dihydroxy-2-phenyl-2,3-dihydrochromen-4-one;ethane (PubChem CID 143810700) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is (2R)-5,7-dihydroxy-2-phenyl-2,3-dihydrochromen-4-one;ethane.
| Compound Name | (2R)-5,7-dihydroxy-2-phenyl-2,3-dihydrochromen-4-one;ethane |
|---|---|
| PubChem CID | 143810700 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | (2R)-5,7-dihydroxy-2-phenyl-2,3-dihydrochromen-4-one;ethane |
| SMILES | CC.O=C1C[C@H](c2ccccc2)Oc2cc(O)cc(O)c21 |
| InChI | InChI=1S/C15H12O4.C2H6/c16-10-6-11(17)15-12(18)8-13(19-14(15)7-10)9-4-2-1-3-5-9;1-2/h1-7,13,16-17H,8H2;1-2H3/t13-;/m1./s1 |
| InChIKey | ZZZOAFIULQJVLJ-BTQNPOSSSA-N |
| XLogP | 3.83 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |