C22H16O6 — CID 169224026
[4-(5,7-dihydroxy-4-oxo-2,3-dihydrochromen-2-yl)phenyl] benzoate (PubChem CID 169224026) has the molecular formula C22H16O6 and a molecular weight of 376.36 g/mol. Its IUPAC name is [4-(5,7-dihydroxy-4-oxo-2,3-dihydrochromen-2-yl)phenyl] benzoate.
| Compound Name | [4-(5,7-dihydroxy-4-oxo-2,3-dihydrochromen-2-yl)phenyl] benzoate |
|---|---|
| PubChem CID | 169224026 |
| Molecular Formula | C22H16O6 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | [4-(5,7-dihydroxy-4-oxo-2,3-dihydrochromen-2-yl)phenyl] benzoate |
| SMILES | O=C(Oc1ccc(C2CC(=O)c3c(O)cc(O)cc3O2)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H16O6/c23-15-10-17(24)21-18(25)12-19(28-20(21)11-15)13-6-8-16(9-7-13)27-22(26)14-4-2-1-3-5-14/h1-11,19,23-24H,12H2 |
| InChIKey | PKOPJENAFARSKF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|