About 2-butan-2-yl-7-methoxy-2,3-dihydrochromen-4-one
2-butan-2-yl-7-methoxy-2,3-dihydrochromen-4-one (PubChem CID 23465807) has the molecular formula C14H18O3
and a molecular weight of 234.29 g/mol. Its IUPAC name is 2-butan-2-yl-7-methoxy-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 2-butan-2-yl-7-methoxy-2,3-dihydrochromen-4-one |
| PubChem CID | 23465807 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 2-butan-2-yl-7-methoxy-2,3-dihydrochromen-4-one |
| SMILES | CCC(C)C1CC(=O)c2ccc(OC)cc2O1 |
| InChI | InChI=1S/C14H18O3/c1-4-9(2)13-8-12(15)11-6-5-10(16-3)7-14(11)17-13/h5-7,9,13H,4,8H2,1-3H3 |
| InChIKey | KFMBADBCSGXYBR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-butan-2-yl-7-methoxy-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-yl-7-methoxy-2,3-dihydrochromen-4-one?
The IUPAC name of 2-butan-2-yl-7-methoxy-2,3-dihydrochromen-4-one (CID 23465807) is 2-butan-2-yl-7-methoxy-2,3-dihydrochromen-4-one.
What is the SMILES notation for 2-butan-2-yl-7-methoxy-2,3-dihydrochromen-4-one?
The canonical SMILES for 2-butan-2-yl-7-methoxy-2,3-dihydrochromen-4-one is CCC(C)C1CC(=O)c2ccc(OC)cc2O1.
What is the InChIKey of 2-butan-2-yl-7-methoxy-2,3-dihydrochromen-4-one?
The InChIKey is KFMBADBCSGXYBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O3/c1-4-9(2)13-8-12(15)11-6-5-10(16-3)7-14(11)17-13/h5-7,9,13H,4,8H2,1-3H3.
What are the key properties of 2-butan-2-yl-7-methoxy-2,3-dihydrochromen-4-one?
2-butan-2-yl-7-methoxy-2,3-dihydrochromen-4-one has a molecular weight of 234.29 g/mol, XLogP of 3.08, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-yl-7-methoxy-2,3-dihydrochromen-4-one is sourced from PubChem (CID 23465807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).