C21H21N3O4 — CID 2854526
1-[7-methoxy-3-(4-nitrophenyl)-3,3a,4,5-tetrahydrobenzo[g]indazol-2-yl]propan-1-one (PubChem CID 2854526) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is 1-[7-methoxy-3-(4-nitrophenyl)-3,3a,4,5-tetrahydrobenzo[g]indazol-2-yl]propan-1-one.
| Compound Name | 1-[7-methoxy-3-(4-nitrophenyl)-3,3a,4,5-tetrahydrobenzo[g]indazol-2-yl]propan-1-one |
|---|---|
| PubChem CID | 2854526 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 1-[7-methoxy-3-(4-nitrophenyl)-3,3a,4,5-tetrahydrobenzo[g]indazol-2-yl]propan-1-one |
| SMILES | CCC(=O)N1N=C2c3ccc(OC)cc3CCC2C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H21N3O4/c1-3-19(25)23-21(13-4-7-15(8-5-13)24(26)27)18-10-6-14-12-16(28-2)9-11-17(14)20(18)22-23/h4-5,7-9,11-12,18,21H,3,6,10H2,1-2H3 |
| InChIKey | KDIRRJVVIGNBOM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 85.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|