C23H23FN2O2 — CID 7340471
(E)-4-[(3S,3aR)-3-(4-fluorophenyl)-7-methoxy-3,3a,4,5-tetrahydrobenzo[g]indazol-2-yl]pent-3-en-2-one (PubChem CID 7340471) has the molecular formula C23H23FN2O2 and a molecular weight of 378.45 g/mol. Its IUPAC name is (E)-4-[(3S,3aR)-3-(4-fluorophenyl)-7-methoxy-3,3a,4,5-tetrahydrobenzo[g]indazol-2-yl]pent-3-en-2-one.
| Compound Name | (E)-4-[(3S,3aR)-3-(4-fluorophenyl)-7-methoxy-3,3a,4,5-tetrahydrobenzo[g]indazol-2-yl]pent-3-en-2-one |
|---|---|
| PubChem CID | 7340471 |
| Molecular Formula | C23H23FN2O2 |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | (E)-4-[(3S,3aR)-3-(4-fluorophenyl)-7-methoxy-3,3a,4,5-tetrahydrobenzo[g]indazol-2-yl]pent-3-en-2-one |
| SMILES | COc1ccc2c(c1)CC[C@H]1C2=NN(/C(C)=C/C(C)=O)[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C23H23FN2O2/c1-14(12-15(2)27)26-23(16-4-7-18(24)8-5-16)21-10-6-17-13-19(28-3)9-11-20(17)22(21)25-26/h4-5,7-9,11-13,21,23H,6,10H2,1-3H3/b14-12+/t21-,23+/m0/s1 |
| InChIKey | DVMRNCHNWCMWFX-KDDHIZETSA-N |
| XLogP | 4.65 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|