C25H28N2O4 — CID 2833409
ethyl 3-[7-methoxy-3-(4-methoxyphenyl)-3,3a,4,5-tetrahydrobenzo[g]indazol-2-yl]but-2-enoate (PubChem CID 2833409) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is ethyl 3-[7-methoxy-3-(4-methoxyphenyl)-3,3a,4,5-tetrahydrobenzo[g]indazol-2-yl]but-2-enoate.
| Compound Name | ethyl 3-[7-methoxy-3-(4-methoxyphenyl)-3,3a,4,5-tetrahydrobenzo[g]indazol-2-yl]but-2-enoate |
|---|---|
| PubChem CID | 2833409 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | ethyl 3-[7-methoxy-3-(4-methoxyphenyl)-3,3a,4,5-tetrahydrobenzo[g]indazol-2-yl]but-2-enoate |
| SMILES | CCOC(=O)C=C(C)N1N=C2c3ccc(OC)cc3CCC2C1c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H28N2O4/c1-5-31-23(28)14-16(2)27-25(17-6-9-19(29-3)10-7-17)22-12-8-18-15-20(30-4)11-13-21(18)24(22)26-27/h6-7,9-11,13-15,22,25H,5,8,12H2,1-4H3 |
| InChIKey | FJTFTZVGRDPERP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|