C24H25N3O5 — CID 1378964
ethyl (Z)-3-[(3S,3aR)-7-methoxy-3-(3-nitrophenyl)-3,3a,4,5-tetrahydrobenzo[g]indazol-2-yl]but-2-enoate (PubChem CID 1378964) has the molecular formula C24H25N3O5 and a molecular weight of 435.48 g/mol. Its IUPAC name is ethyl (Z)-3-[(3S,3aR)-7-methoxy-3-(3-nitrophenyl)-3,3a,4,5-tetrahydrobenzo[g]indazol-2-yl]but-2-enoate.
| Compound Name | ethyl (Z)-3-[(3S,3aR)-7-methoxy-3-(3-nitrophenyl)-3,3a,4,5-tetrahydrobenzo[g]indazol-2-yl]but-2-enoate |
|---|---|
| PubChem CID | 1378964 |
| Molecular Formula | C24H25N3O5 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | ethyl (Z)-3-[(3S,3aR)-7-methoxy-3-(3-nitrophenyl)-3,3a,4,5-tetrahydrobenzo[g]indazol-2-yl]but-2-enoate |
| SMILES | CCOC(=O)/C=C(/C)N1N=C2c3ccc(OC)cc3CC[C@@H]2[C@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H25N3O5/c1-4-32-22(28)12-15(2)26-24(17-6-5-7-18(13-17)27(29)30)21-10-8-16-14-19(31-3)9-11-20(16)23(21)25-26/h5-7,9,11-14,21,24H,4,8,10H2,1-3H3/b15-12-/t21-,24+/m0/s1 |
| InChIKey | FXRKALUPBVTLJQ-UWZQHRONSA-N |
| XLogP | 4.39 |
| TPSA | 94.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|