C14H13NO6 — CID 13416112
6,6-dimethyl-2-(4-nitrophenyl)-5,7-dioxaspiro[2.5]octane-4,8-dione (PubChem CID 13416112) has the molecular formula C14H13NO6 and a molecular weight of 291.26 g/mol. Its IUPAC name is 6,6-dimethyl-2-(4-nitrophenyl)-5,7-dioxaspiro[2.5]octane-4,8-dione.
| Compound Name | 6,6-dimethyl-2-(4-nitrophenyl)-5,7-dioxaspiro[2.5]octane-4,8-dione |
|---|---|
| PubChem CID | 13416112 |
| Molecular Formula | C14H13NO6 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 6,6-dimethyl-2-(4-nitrophenyl)-5,7-dioxaspiro[2.5]octane-4,8-dione |
| SMILES | CC1(C)OC(=O)C2(CC2c2ccc([N+](=O)[O-])cc2)C(=O)O1 |
| InChI | InChI=1S/C14H13NO6/c1-13(2)20-11(16)14(12(17)21-13)7-10(14)8-3-5-9(6-4-8)15(18)19/h3-6,10H,7H2,1-2H3 |
| InChIKey | KUXFWMGOCNUFEC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|