C11H14N2O4 — CID 102046369
[(2R,4R)-4-methyl-2-(4-nitrophenyl)-1,3-oxazolidin-4-yl]methanol (PubChem CID 102046369) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is [(2R,4R)-4-methyl-2-(4-nitrophenyl)-1,3-oxazolidin-4-yl]methanol.
| Compound Name | [(2R,4R)-4-methyl-2-(4-nitrophenyl)-1,3-oxazolidin-4-yl]methanol |
|---|---|
| PubChem CID | 102046369 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | [(2R,4R)-4-methyl-2-(4-nitrophenyl)-1,3-oxazolidin-4-yl]methanol |
| SMILES | C[C@@]1(CO)CO[C@H](c2ccc([N+](=O)[O-])cc2)N1 |
| InChI | InChI=1S/C11H14N2O4/c1-11(6-14)7-17-10(12-11)8-2-4-9(5-3-8)13(15)16/h2-5,10,12,14H,6-7H2,1H3/t10-,11-/m1/s1 |
| InChIKey | DFMJSGURPFISFN-GHMZBOCLSA-N |
| XLogP | 0.96 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|