C11H15N2O3+ — CID 7309008
(2S)-4,4-dimethyl-2-(4-nitrophenyl)-1,3-oxazolidin-3-ium (PubChem CID 7309008) has the molecular formula C11H15N2O3+ and a molecular weight of 223.25 g/mol. Its IUPAC name is (2S)-4,4-dimethyl-2-(4-nitrophenyl)-1,3-oxazolidin-3-ium.
| Compound Name | (2S)-4,4-dimethyl-2-(4-nitrophenyl)-1,3-oxazolidin-3-ium |
|---|---|
| PubChem CID | 7309008 |
| Molecular Formula | C11H15N2O3+ |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | (2S)-4,4-dimethyl-2-(4-nitrophenyl)-1,3-oxazolidin-3-ium |
| SMILES | CC1(C)CO[C@@H](c2ccc([N+](=O)[O-])cc2)[NH2+]1 |
| InChI | InChI=1S/C11H14N2O3/c1-11(2)7-16-10(12-11)8-3-5-9(6-4-8)13(14)15/h3-6,10,12H,7H2,1-2H3/p+1/t10-/m0/s1 |
| InChIKey | ZPNMOPHVOROCRG-JTQLQIEISA-O |
| XLogP | 0.97 |
| TPSA | 68.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|