C11H15ClNO+ — CID 6948958
(2S)-2-(3-chlorophenyl)-4,4-dimethyl-1,3-oxazolidin-3-ium (PubChem CID 6948958) has the molecular formula C11H15ClNO+ and a molecular weight of 212.70 g/mol. Its IUPAC name is (2S)-2-(3-chlorophenyl)-4,4-dimethyl-1,3-oxazolidin-3-ium.
| Compound Name | (2S)-2-(3-chlorophenyl)-4,4-dimethyl-1,3-oxazolidin-3-ium |
|---|---|
| PubChem CID | 6948958 |
| Molecular Formula | C11H15ClNO+ |
| Molecular Weight | 212.70 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | (2S)-2-(3-chlorophenyl)-4,4-dimethyl-1,3-oxazolidin-3-ium |
| SMILES | CC1(C)CO[C@@H](c2cccc(Cl)c2)[NH2+]1 |
| InChI | InChI=1S/C11H14ClNO/c1-11(2)7-14-10(13-11)8-4-3-5-9(12)6-8/h3-6,10,13H,7H2,1-2H3/p+1/t10-/m0/s1 |
| InChIKey | RRBXUQDCHSUXJY-JTQLQIEISA-O |
| XLogP | 1.71 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.70 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |