C21H22Cl2O — CID 141326895
(2R,3R,5S)-3-(3-chlorophenyl)-2-(4-chlorophenyl)-5-methyl-5-prop-2-enyloxane (PubChem CID 141326895) has the molecular formula C21H22Cl2O and a molecular weight of 361.31 g/mol. Its IUPAC name is (2R,3R,5S)-3-(3-chlorophenyl)-2-(4-chlorophenyl)-5-methyl-5-prop-2-enyloxane.
| Compound Name | (2R,3R,5S)-3-(3-chlorophenyl)-2-(4-chlorophenyl)-5-methyl-5-prop-2-enyloxane |
|---|---|
| PubChem CID | 141326895 |
| Molecular Formula | C21H22Cl2O |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | (2R,3R,5S)-3-(3-chlorophenyl)-2-(4-chlorophenyl)-5-methyl-5-prop-2-enyloxane |
| SMILES | C=CC[C@]1(C)CO[C@@H](c2ccc(Cl)cc2)[C@@H](c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C21H22Cl2O/c1-3-11-21(2)13-19(16-5-4-6-18(23)12-16)20(24-14-21)15-7-9-17(22)10-8-15/h3-10,12,19-20H,1,11,13-14H2,2H3/t19-,20+,21+/m1/s1 |
| InChIKey | YWFDPTJDBUIPJH-HKBOAZHASA-N |
| XLogP | 6.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|