C27H31Cl2NO2 — CID 123467449
5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-ethyl-1-(2-oxopentan-3-yl)-3-prop-2-enylpiperidin-2-one (PubChem CID 123467449) has the molecular formula C27H31Cl2NO2 and a molecular weight of 472.46 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-ethyl-1-(2-oxopentan-3-yl)-3-prop-2-enylpiperidin-2-one.
| Compound Name | 5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-ethyl-1-(2-oxopentan-3-yl)-3-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 123467449 |
| Molecular Formula | C27H31Cl2NO2 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-ethyl-1-(2-oxopentan-3-yl)-3-prop-2-enylpiperidin-2-one |
| SMILES | C=CCC1(CC)CC(c2cccc(Cl)c2)C(c2ccc(Cl)cc2)N(C(CC)C(C)=O)C1=O |
| InChI | InChI=1S/C27H31Cl2NO2/c1-5-15-27(7-3)17-23(20-9-8-10-22(29)16-20)25(19-11-13-21(28)14-12-19)30(26(27)32)24(6-2)18(4)31/h5,8-14,16,23-25H,1,6-7,15,17H2,2-4H3 |
| InChIKey | FQGSBDAUAMPFNK-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|