C25H27Cl2NO3 — CID 76834394
2-[5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxo-3-prop-2-enylpiperidin-1-yl]butanoic acid (PubChem CID 76834394) has the molecular formula C25H27Cl2NO3 and a molecular weight of 460.40 g/mol. Its IUPAC name is 2-[5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxo-3-prop-2-enylpiperidin-1-yl]butanoic acid.
| Compound Name | 2-[5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxo-3-prop-2-enylpiperidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 76834394 |
| Molecular Formula | C25H27Cl2NO3 |
| Molecular Weight | 460.40 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 2-[5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxo-3-prop-2-enylpiperidin-1-yl]butanoic acid |
| SMILES | C=CCC1(C)CC(c2cccc(Cl)c2)C(c2ccc(Cl)cc2)N(C(CC)C(=O)O)C1=O |
| InChI | InChI=1S/C25H27Cl2NO3/c1-4-13-25(3)15-20(17-7-6-8-19(27)14-17)22(16-9-11-18(26)12-10-16)28(24(25)31)21(5-2)23(29)30/h4,6-12,14,20-22H,1,5,13,15H2,2-3H3,(H,29,30) |
| InChIKey | ZPSQWQNPYHMAFU-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.40 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|