C28H35Cl2NO2 — CID 67999318
(3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(3S)-6-hydroxyheptan-3-yl]-3-methyl-3-prop-2-enylpiperidin-2-one (PubChem CID 67999318) has the molecular formula C28H35Cl2NO2 and a molecular weight of 488.50 g/mol. Its IUPAC name is (3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(3S)-6-hydroxyheptan-3-yl]-3-methyl-3-prop-2-enylpiperidin-2-one.
| Compound Name | (3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(3S)-6-hydroxyheptan-3-yl]-3-methyl-3-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 67999318 |
| Molecular Formula | C28H35Cl2NO2 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | (3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(3S)-6-hydroxyheptan-3-yl]-3-methyl-3-prop-2-enylpiperidin-2-one |
| SMILES | C=CC[C@@]1(C)C[C@H](c2cccc(Cl)c2)[C@@H](c2ccc(Cl)cc2)N([C@@H](CC)CCC(C)O)C1=O |
| InChI | InChI=1S/C28H35Cl2NO2/c1-5-16-28(4)18-25(21-8-7-9-23(30)17-21)26(20-11-13-22(29)14-12-20)31(27(28)33)24(6-2)15-10-19(3)32/h5,7-9,11-14,17,19,24-26,32H,1,6,10,15-16,18H2,2-4H3/t19?,24-,25+,26+,28-/m0/s1 |
| InChIKey | KVTHABBHNSBLLE-PRLTVRJWSA-N |
| XLogP | 7.57 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|