C29H34Cl2F3NO2 — CID 170188514
(3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-3-prop-2-enyl-1-(7,7,7-trifluoro-6-hydroxy-6-methylheptan-3-yl)piperidin-2-one (PubChem CID 170188514) has the molecular formula C29H34Cl2F3NO2 and a molecular weight of 556.50 g/mol. Its IUPAC name is (3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-3-prop-2-enyl-1-(7,7,7-trifluoro-6-hydroxy-6-methylheptan-3-yl)piperidin-2-one.
| Compound Name | (3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-3-prop-2-enyl-1-(7,7,7-trifluoro-6-hydroxy-6-methylheptan-3-yl)piperidin-2-one |
|---|---|
| PubChem CID | 170188514 |
| Molecular Formula | C29H34Cl2F3NO2 |
| Molecular Weight | 556.50 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | (3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-3-prop-2-enyl-1-(7,7,7-trifluoro-6-hydroxy-6-methylheptan-3-yl)piperidin-2-one |
| SMILES | C=CC[C@@]1(C)C[C@H](c2cccc(Cl)c2)[C@@H](c2ccc(Cl)cc2)N(C(CC)CCC(C)(O)C(F)(F)F)C1=O |
| InChI | InChI=1S/C29H34Cl2F3NO2/c1-5-15-27(3)18-24(20-8-7-9-22(31)17-20)25(19-10-12-21(30)13-11-19)35(26(27)36)23(6-2)14-16-28(4,37)29(32,33)34/h5,7-13,17,23-25,37H,1,6,14-16,18H2,2-4H3/t23?,24-,25-,27+,28?/m1/s1 |
| InChIKey | YBIUCABCYKYEHI-ZWCXUAEOSA-N |
| XLogP | 8.51 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.50 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|