C28H32Cl2F3NO — CID 123826317
5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-ethyl-3-prop-2-enyl-1-(6,6,6-trifluorohexan-3-yl)piperidin-2-one (PubChem CID 123826317) has the molecular formula C28H32Cl2F3NO and a molecular weight of 526.47 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-ethyl-3-prop-2-enyl-1-(6,6,6-trifluorohexan-3-yl)piperidin-2-one.
| Compound Name | 5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-ethyl-3-prop-2-enyl-1-(6,6,6-trifluorohexan-3-yl)piperidin-2-one |
|---|---|
| PubChem CID | 123826317 |
| Molecular Formula | C28H32Cl2F3NO |
| Molecular Weight | 526.47 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | 5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-ethyl-3-prop-2-enyl-1-(6,6,6-trifluorohexan-3-yl)piperidin-2-one |
| SMILES | C=CCC1(CC)CC(c2cccc(Cl)c2)C(c2ccc(Cl)cc2)N(C(CC)CCC(F)(F)F)C1=O |
| InChI | InChI=1S/C28H32Cl2F3NO/c1-4-15-27(6-3)18-24(20-8-7-9-22(30)17-20)25(19-10-12-21(29)13-11-19)34(26(27)35)23(5-2)14-16-28(31,32)33/h4,7-13,17,23-25H,1,5-6,14-16,18H2,2-3H3 |
| InChIKey | PTVFACISKNFGIJ-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.47 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|