C56H70Cl4N2O4 — CID 161108671
(3S,5R)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(3S)-5-hydroxy-5-methylhexan-3-yl]-3-methyl-3-prop-2-enylpiperidin-2-one (PubChem CID 161108671) has the molecular formula C56H70Cl4N2O4 and a molecular weight of 977.00 g/mol. Its IUPAC name is (3S,5R)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(3S)-5-hydroxy-5-methylhexan-3-yl]-3-methyl-3-prop-2-enylpiperidin-2-one.
| Compound Name | (3S,5R)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(3S)-5-hydroxy-5-methylhexan-3-yl]-3-methyl-3-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 161108671 |
| Molecular Formula | C56H70Cl4N2O4 |
| Molecular Weight | 977.00 g/mol |
| Exact Mass | 974.41 |
| IUPAC Name | (3S,5R)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(3S)-5-hydroxy-5-methylhexan-3-yl]-3-methyl-3-prop-2-enylpiperidin-2-one |
| SMILES | C=CC[C@@]1(C)C[C@H](c2cccc(Cl)c2)C(c2ccc(Cl)cc2)N([C@@H](CC)CC(C)(C)O)C1=O.C=CC[C@@]1(C)C[C@H](c2cccc(Cl)c2)C(c2ccc(Cl)cc2)N([C@@H](CC)CC(C)(C)O)C1=O |
| InChI | InChI=1S/2C28H35Cl2NO2/c2*1-6-15-28(5)18-24(20-9-8-10-22(30)16-20)25(19-11-13-21(29)14-12-19)31(26(28)32)23(7-2)17-27(3,4)33/h2*6,8-14,16,23-25,33H,1,7,15,17-18H2,2-5H3/t2*23-,24+,25?,28-/m00/s1 |
| InChIKey | UJKFHVPORLPFED-BCAAIGBYSA-N |
| XLogP | 15.15 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 977.00 |
| LogP ≤ 5 | 15.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|