C29H37Cl2N3O — CID 76834552
5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-1-(1-piperazin-1-ylbutan-2-yl)-3-prop-2-enylpiperidin-2-one (PubChem CID 76834552) has the molecular formula C29H37Cl2N3O and a molecular weight of 514.54 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-1-(1-piperazin-1-ylbutan-2-yl)-3-prop-2-enylpiperidin-2-one.
| Compound Name | 5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-1-(1-piperazin-1-ylbutan-2-yl)-3-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 76834552 |
| Molecular Formula | C29H37Cl2N3O |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | 5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-1-(1-piperazin-1-ylbutan-2-yl)-3-prop-2-enylpiperidin-2-one |
| SMILES | C=CCC1(C)CC(c2cccc(Cl)c2)C(c2ccc(Cl)cc2)N(C(CC)CN2CCNCC2)C1=O |
| InChI | InChI=1S/C29H37Cl2N3O/c1-4-13-29(3)19-26(22-7-6-8-24(31)18-22)27(21-9-11-23(30)12-10-21)34(28(29)35)25(5-2)20-33-16-14-32-15-17-33/h4,6-12,18,25-27,32H,1,5,13-17,19-20H2,2-3H3 |
| InChIKey | QXGGUAKSOUFFSN-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|