C27H33Cl2NO3 — CID 58574017
(3S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(3S)-5,5-dihydroxyhexan-3-yl]-3-methyl-3-prop-2-enylpiperidin-2-one (PubChem CID 58574017) has the molecular formula C27H33Cl2NO3 and a molecular weight of 490.47 g/mol. Its IUPAC name is (3S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(3S)-5,5-dihydroxyhexan-3-yl]-3-methyl-3-prop-2-enylpiperidin-2-one.
| Compound Name | (3S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(3S)-5,5-dihydroxyhexan-3-yl]-3-methyl-3-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 58574017 |
| Molecular Formula | C27H33Cl2NO3 |
| Molecular Weight | 490.47 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | (3S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(3S)-5,5-dihydroxyhexan-3-yl]-3-methyl-3-prop-2-enylpiperidin-2-one |
| SMILES | C=CC[C@@]1(C)CC(c2cccc(Cl)c2)C(c2ccc(Cl)cc2)N([C@@H](CC)CC(C)(O)O)C1=O |
| InChI | InChI=1S/C27H33Cl2NO3/c1-5-14-26(3)17-23(19-8-7-9-21(29)15-19)24(18-10-12-20(28)13-11-18)30(25(26)31)22(6-2)16-27(4,32)33/h5,7-13,15,22-24,32-33H,1,6,14,16-17H2,2-4H3/t22-,23?,24?,26-/m0/s1 |
| InChIKey | UEHVFXCSRGXGOT-IDABCOFVSA-N |
| XLogP | 6.50 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.47 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|