C25H29Cl2NO2 — CID 58573191
2-[(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxo-1-pentan-3-ylpiperidin-3-yl]acetaldehyde (PubChem CID 58573191) has the molecular formula C25H29Cl2NO2 and a molecular weight of 446.42 g/mol. Its IUPAC name is 2-[(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxo-1-pentan-3-ylpiperidin-3-yl]acetaldehyde.
| Compound Name | 2-[(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxo-1-pentan-3-ylpiperidin-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 58573191 |
| Molecular Formula | C25H29Cl2NO2 |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 2-[(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxo-1-pentan-3-ylpiperidin-3-yl]acetaldehyde |
| SMILES | CCC(CC)N1C(=O)[C@@](C)(CC=O)C[C@H](c2cccc(Cl)c2)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H29Cl2NO2/c1-4-21(5-2)28-23(17-9-11-19(26)12-10-17)22(18-7-6-8-20(27)15-18)16-25(3,13-14-29)24(28)30/h6-12,14-15,21-23H,4-5,13,16H2,1-3H3/t22-,23-,25+/m1/s1 |
| InChIKey | PTZFUPROOCRWTE-OYRHQHFDSA-N |
| XLogP | 6.83 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|