C25H31Cl2N3O2 — CID 67999881
2-[(3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxo-1-pentan-3-ylpiperidin-3-yl]acetohydrazide (PubChem CID 67999881) has the molecular formula C25H31Cl2N3O2 and a molecular weight of 476.45 g/mol. Its IUPAC name is 2-[(3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxo-1-pentan-3-ylpiperidin-3-yl]acetohydrazide.
| Compound Name | 2-[(3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxo-1-pentan-3-ylpiperidin-3-yl]acetohydrazide |
|---|---|
| PubChem CID | 67999881 |
| Molecular Formula | C25H31Cl2N3O2 |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 2-[(3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxo-1-pentan-3-ylpiperidin-3-yl]acetohydrazide |
| SMILES | CCC(CC)N1C(=O)[C@](C)(CC(=O)NN)C[C@H](c2cccc(Cl)c2)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H31Cl2N3O2/c1-4-20(5-2)30-23(16-9-11-18(26)12-10-16)21(17-7-6-8-19(27)13-17)14-25(3,24(30)32)15-22(31)29-28/h6-13,20-21,23H,4-5,14-15,28H2,1-3H3,(H,29,31)/t21-,23-,25+/m1/s1 |
| InChIKey | VRQVUCXSRFQVCU-PFATUAPWSA-N |
| XLogP | 5.63 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|