C28H35Cl2N3O5S — CID 88546752
2-[(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-1-[(2S)-1-[(1-methylcyclopropyl)sulfonylamino]butan-2-yl]-2-oxopiperidin-3-yl]-N-hydroxyacetamide (PubChem CID 88546752) has the molecular formula C28H35Cl2N3O5S and a molecular weight of 596.58 g/mol. Its IUPAC name is 2-[(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-1-[(2S)-1-[(1-methylcyclopropyl)sulfonylamino]butan-2-yl]-2-oxopiperidin-3-yl]-N-hydroxyacetamide.
| Compound Name | 2-[(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-1-[(2S)-1-[(1-methylcyclopropyl)sulfonylamino]butan-2-yl]-2-oxopiperidin-3-yl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 88546752 |
| Molecular Formula | C28H35Cl2N3O5S |
| Molecular Weight | 596.58 g/mol |
| Exact Mass | 595.17 |
| IUPAC Name | 2-[(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-1-[(2S)-1-[(1-methylcyclopropyl)sulfonylamino]butan-2-yl]-2-oxopiperidin-3-yl]-N-hydroxyacetamide |
| SMILES | CC[C@@H](CNS(=O)(=O)C1(C)CC1)N1C(=O)[C@@](C)(CC(=O)NO)C[C@H](c2cccc(Cl)c2)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H35Cl2N3O5S/c1-4-22(17-31-39(37,38)28(3)12-13-28)33-25(18-8-10-20(29)11-9-18)23(19-6-5-7-21(30)14-19)15-27(2,26(33)35)16-24(34)32-36/h5-11,14,22-23,25,31,36H,4,12-13,15-17H2,1-3H3,(H,32,34)/t22-,23+,25+,27+/m0/s1 |
| InChIKey | RKJDKFPUCKRPCM-CXQACEEJSA-N |
| XLogP | 5.20 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.58 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|