C27H31Cl2NO2 — CID 170188526
(3S,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-1-(5-oxohexan-3-yl)-3-prop-2-enylpiperidin-2-one (PubChem CID 170188526) has the molecular formula C27H31Cl2NO2 and a molecular weight of 472.46 g/mol. Its IUPAC name is (3S,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-1-(5-oxohexan-3-yl)-3-prop-2-enylpiperidin-2-one.
| Compound Name | (3S,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-1-(5-oxohexan-3-yl)-3-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 170188526 |
| Molecular Formula | C27H31Cl2NO2 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | (3S,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-1-(5-oxohexan-3-yl)-3-prop-2-enylpiperidin-2-one |
| SMILES | C=CC[C@@]1(C)CC(c2cccc(Cl)c2)[C@@H](c2ccc(Cl)cc2)N(C(CC)CC(C)=O)C1=O |
| InChI | InChI=1S/C27H31Cl2NO2/c1-5-14-27(4)17-24(20-8-7-9-22(29)16-20)25(19-10-12-21(28)13-11-19)30(26(27)32)23(6-2)15-18(3)31/h5,7-13,16,23-25H,1,6,14-15,17H2,2-4H3/t23?,24?,25-,27+/m1/s1 |
| InChIKey | CZDWAMLMJLILOA-NYSKWXQQSA-N |
| XLogP | 7.39 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|