C28H32Cl2F3NO2 — CID 170188554
(3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-3-prop-2-enyl-1-(6,6,6-trifluoro-5-hydroxy-5-methylhexan-3-yl)piperidin-2-one (PubChem CID 170188554) has the molecular formula C28H32Cl2F3NO2 and a molecular weight of 542.47 g/mol. Its IUPAC name is (3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-3-prop-2-enyl-1-(6,6,6-trifluoro-5-hydroxy-5-methylhexan-3-yl)piperidin-2-one.
| Compound Name | (3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-3-prop-2-enyl-1-(6,6,6-trifluoro-5-hydroxy-5-methylhexan-3-yl)piperidin-2-one |
|---|---|
| PubChem CID | 170188554 |
| Molecular Formula | C28H32Cl2F3NO2 |
| Molecular Weight | 542.47 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | (3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-3-prop-2-enyl-1-(6,6,6-trifluoro-5-hydroxy-5-methylhexan-3-yl)piperidin-2-one |
| SMILES | C=CC[C@@]1(C)C[C@H](c2cccc(Cl)c2)[C@@H](c2ccc(Cl)cc2)N(C(CC)CC(C)(O)C(F)(F)F)C1=O |
| InChI | InChI=1S/C28H32Cl2F3NO2/c1-5-14-26(3)17-23(19-8-7-9-21(30)15-19)24(18-10-12-20(29)13-11-18)34(25(26)35)22(6-2)16-27(4,36)28(31,32)33/h5,7-13,15,22-24,36H,1,6,14,16-17H2,2-4H3/t22?,23-,24-,26+,27?/m1/s1 |
| InChIKey | VJMIEHNLCUKQLC-ICDYKQTMSA-N |
| XLogP | 8.11 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.47 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|