C27H33Cl2NO — CID 123577640
5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-hexan-3-yl-3-methyl-3-prop-2-enylpiperidin-2-one (PubChem CID 123577640) has the molecular formula C27H33Cl2NO and a molecular weight of 458.47 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-hexan-3-yl-3-methyl-3-prop-2-enylpiperidin-2-one.
| Compound Name | 5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-hexan-3-yl-3-methyl-3-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 123577640 |
| Molecular Formula | C27H33Cl2NO |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-hexan-3-yl-3-methyl-3-prop-2-enylpiperidin-2-one |
| SMILES | C=CCC1(C)CC(c2cccc(Cl)c2)C(c2ccc(Cl)cc2)N(C(CC)CCC)C1=O |
| InChI | InChI=1S/C27H33Cl2NO/c1-5-9-23(7-3)30-25(19-12-14-21(28)15-13-19)24(20-10-8-11-22(29)17-20)18-27(4,16-6-2)26(30)31/h6,8,10-15,17,23-25H,2,5,7,9,16,18H2,1,3-4H3 |
| InChIKey | RTCVIUQIWLYHRE-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|