C30H37Cl2NOS — CID 123642244
5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-(1-cyclopropyl-2-ethylsulfanylethyl)-3-prop-2-enyl-3-propylpiperidin-2-one (PubChem CID 123642244) has the molecular formula C30H37Cl2NOS and a molecular weight of 530.61 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-(1-cyclopropyl-2-ethylsulfanylethyl)-3-prop-2-enyl-3-propylpiperidin-2-one.
| Compound Name | 5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-(1-cyclopropyl-2-ethylsulfanylethyl)-3-prop-2-enyl-3-propylpiperidin-2-one |
|---|---|
| PubChem CID | 123642244 |
| Molecular Formula | C30H37Cl2NOS |
| Molecular Weight | 530.61 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | 5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-(1-cyclopropyl-2-ethylsulfanylethyl)-3-prop-2-enyl-3-propylpiperidin-2-one |
| SMILES | C=CCC1(CCC)CC(c2cccc(Cl)c2)C(c2ccc(Cl)cc2)N(C(CSCC)C2CC2)C1=O |
| InChI | InChI=1S/C30H37Cl2NOS/c1-4-16-30(17-5-2)19-26(23-8-7-9-25(32)18-23)28(22-12-14-24(31)15-13-22)33(29(30)34)27(20-35-6-3)21-10-11-21/h4,7-9,12-15,18,21,26-28H,1,5-6,10-11,16-17,19-20H2,2-3H3 |
| InChIKey | LVZFGIKXXGNWGL-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.61 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|